QSAR Modeling
When to Use
- Predicting bioactivity (active/inactive, pIC50, Ki) for compounds from SMILES using a trained model.
- Building a structure-activity relationship (SAR) model from ChEMBL/PubChem bioactivity assay data.
- Scoring a virtual screening library and flagging predictions that fall outside the training chemical space.
- Comparing scaffold-based vs. random train/test splits to get a realistic estimate of generalization.
- Prioritizing synthesis candidates by combining a QSAR activity score with an applicability domain (AD) flag.
Version Compatibility
- Python ≥3.10, RDKit ≥2023.09, scikit-learn ≥1.4, pandas ≥2.0, chembl_webresource_client ≥0.10.
Prerequisites
pip install rdkit chembl_webresource_client scikit-learn pandas numpy- Familiarity with SMILES and basic ML classification metrics (AUC-ROC, MCC).
- Related skills:
bio-chemoinformatics-molecular-descriptors,bio-chemoinformatics-similarity-searching,bio-chemoinformatics-virtual-screening.
1. Data Retrieval from ChEMBL
Goal: pull bioactivity measurements (IC50) for a target protein.
Approach: query new_client.activity filtered by target_chembl_id and standard_type, restricted to the fields needed downstream.
from chembl_webresource_client.new_client import new_client
import pandas as pd
def fetch_chembl_ic50(target_chembl_id: str = "CHEMBL203") -> pd.DataFrame:
"""Fetch IC50 bioactivity records for a ChEMBL target (default: EGFR).
Returns a DataFrame with molecule_chembl_id, standard_value (nM),
standard_units, and canonical_smiles.
"""
activity = new_client.activity
records = activity.filter(
target_chembl_id=target_chembl_id,
standard_type="IC50",
).only(
["molecule_chembl_id", "standard_value", "standard_units", "canonical_smiles"]
)
return pd.DataFrame(list(records))
2. Data Curation
Goal: turn raw IC50 values into a clean binary activity label.
Approach: drop missing/invalid rows, convert nM IC50 to pIC50 (-log10(IC50_M)), collapse duplicate compounds to their median pIC50, and threshold at pIC50 ≥ 6 (IC50 ≤ 1 µM) for "active".
import numpy as np
def curate_activity(df: pd.DataFrame, active_threshold: float = 6.0) -> pd.DataFrame:
"""Convert IC50 (nM) to pIC50, dedupe by median, and label active/inactive."""
df = df.dropna(subset=["standard_value", "canonical_smiles"]).copy()
df["standard_value"] = pd.to_numeric(df["standard_value"], errors="coerce")
df = df[df["standard_value"] > 0]
df["pIC50"] = -np.log10(df["standard_value"] * 1e-9)
# Keep median pIC50 per compound to reduce assay noise
df = (
df.groupby(["molecule_chembl_id", "canonical_smiles"], as_index=False)["pIC50"]
.median()
)
df["active"] = (df["pIC50"] >= active_threshold).astype(int)
return df
3. Feature Generation
Goal: turn each SMILES into a numeric feature vector. Approach: compute a 2048-bit Morgan fingerprint (radius 2 ≈ ECFP4) plus the full set of RDKit 2D descriptors; concatenate them. Invalid SMILES are skipped and their rows dropped.
from rdkit import Chem
from rdkit.Chem import AllChem, Descriptors
from rdkit.ML.Descriptors import MoleculeDescriptors
_DESC_NAMES = [name for name, _ in Descriptors.descList]
_CALC = MoleculeDescriptors.MolecularDescriptorCalculator(_DESC_NAMES)
def featurize(smiles_list, n_bits: int = 2048, radius: int = 2):
"""Compute Morgan fingerprint + RDKit 2D descriptors for each SMILES.
Returns (X, valid_mask) where X is an (n_valid, n_bits + n_descriptors)
float array and valid_mask marks which input rows parsed successfully.
"""
rows, valid_mask = [], []
for smi in smiles_list:
mol = Chem.MolFromSmiles(smi)
if mol is None:
valid_mask.append(False)
continue
fp = list(AllChem.GetMorganFingerprintAsBitVect(mol, radius, n_bits))
desc = list(_CALC.CalcDescriptors(mol))
rows.append(fp + desc)
valid_mask.append(True)
X = np.array(rows, dtype=float)
return X, np.array(valid_mask)
4. Scaffold Split, Training, and Evaluation
Goal: train a classifier and evaluate it honestly (scaffold split avoids leaking near-duplicate analogs between train/test).
Approach: bin molecules by Murcko scaffold, assign whole scaffold groups to train/test, then fit RandomForestClassifier and score with AUC-ROC and MCC.
from collections import defaultdict
from rdkit.Chem.Scaffolds import MurckoScaffold
from sklearn.ensemble import RandomForestClassifier
from sklearn.metrics import roc_auc_score, matthews_corrcoef
def scaffold_split(smiles_list, test_frac: float = 0.2, seed: int = 42):
"""Split molecule indices into train/test by Bemis-Murcko scaffold.
Whole scaffold groups go entirely to train or test, so structurally
near-identical analogs never straddle the split (unlike a random split).
"""
scaffold_to_idx = defaultdict(list)
for i, smi in enumerate(smiles_list):
mol = Chem.MolFromSmiles(smi)
scaffold = MurckoScaffold.MurckoScaffoldSmiles(mol=mol) if mol else ""
scaffold_to_idx[scaffold].append(i)
rng = np.random.RandomState(seed)
groups = list(scaffold_to_idx.values())
rng.shuffle(groups)
n_total = len(smiles_list)
test_idx, train_idx = [], []
for group in groups:
if len(test_idx) < test_frac * n_total:
test_idx.extend(group)
else:
train_idx.extend(group)
return np.array(train_idx), np.array(test_idx)
def train_and_evaluate(X, y, train_idx, test_idx, seed: int = 42):
"""Fit a Random Forest QSAR classifier and report AUC-ROC and MCC."""
X_train, X_test = X[train_idx], X[test_idx]
y_train, y_test = y[train_idx], y[test_idx]
rf = RandomForestClassifier(n_estimators=500, random_state=seed, n_jobs=-1)
rf.fit(X_train, y_train)
y_pred = rf.predict(X_test)
y_prob = rf.predict_proba(X_test)[:, 1]
metrics = {
"auc_roc": roc_auc_score(y_test, y_prob),
"mcc": matthews_corrcoef(y_test, y_pred),
}
return rf, metrics
5. Applicability Domain (AD)
Goal: flag test/new compounds too dissimilar from the training set for the model's predictions to be trusted.
Approach: compute mean distance to the k=5 nearest training-set neighbors; anything beyond mean + 3*std of the training self-distances is out of domain.
from sklearn.neighbors import NearestNeighbors
def applicability_domain(X_train, X_query, n_neighbors: int = 5, z: float = 3.0):
"""Flag query compounds outside the k-NN applicability domain of X_train.
Returns (in_ad, avg_distances) — in_ad is a boolean array over X_query.
"""
knn = NearestNeighbors(n_neighbors=n_neighbors)
knn.fit(X_train)
# Threshold from training set's own leave-one-out neighbor distances
train_dist, _ = knn.kneighbors(X_train, n_neighbors=n_neighbors + 1)
train_avg = train_dist[:, 1:].mean(axis=1) # drop self-match at index 0
threshold = train_avg.mean() + z * train_avg.std()
query_dist, _ = knn.kneighbors(X_query, n_neighbors=n_neighbors)
query_avg = query_dist.mean(axis=1)
return query_avg <= threshold, query_avg
def demo():
"""Self-check: featurize toy SMILES, scaffold-split, train, AD-check."""
smiles = [
"CCOc1ccc(cc1)C(=O)Nc1ccccc1", "CCOc1ccc(cc1)C(=O)Nc1ccccn1",
"c1ccccc1C(=O)O", "c1ccccc1C(=O)N", "CCN(CC)CCOC(=O)c1ccccc1N",
"CCN(CC)CCOC(=O)c1ccccc1", "COc1ccccc1", "COc1ccccc1O",
]
y = np.array([1, 1, 0, 0, 1, 1, 0, 0])
X, mask = featurize(smiles)
assert X.shape[0] == len(smiles) and mask.all()
train_idx, test_idx = scaffold_split(smiles, test_frac=0.25, seed=0)
assert len(train_idx) + len(test_idx) == len(smiles)
rf, metrics = train_and_evaluate(X, y, train_idx, test_idx)
assert 0.0 <= metrics["auc_roc"] <= 1.0
in_ad, dist = applicability_domain(X[train_idx], X[test_idx])
assert in_ad.shape[0] == len(test_idx)
print("demo OK:", metrics, "in_ad:", in_ad.tolist())
if __name__ == "__main__":
demo()
Pitfalls
- SMILES canonicalization: different SMILES can represent the same molecule; canonicalize (
Chem.MolToSmiles) before deduplicating. - Stereochemistry: default Morgan fingerprints ignore chirality unless
useChirality=Trueis passed, which can merge enantiomers with different bioactivity. - Descriptor scaling: RDKit 2D descriptors span wildly different ranges (MW vs. fraction Csp3); standardize (
StandardScaler) before distance-based steps like AD or SVM/kNN. - Random vs. scaffold split: a random split lets near-duplicate analogs leak between train/test, inflating AUC/MCC — always report scaffold-split metrics for realistic generalization estimates.
- Applicability domain threshold: the
mean + 3*stdk-NN rule is a heuristic, not a guarantee; tunen_neighbors/zagainst a held-out validation set for your chemical series. - Class imbalance: bioactivity datasets are often skewed toward actives or inactives depending on the assay; stratify splits and prefer MCC/AUC-PR over raw accuracy.
See Also
bio-chemoinformatics-molecular-descriptorsbio-chemoinformatics-similarity-searchingbio-chemoinformatics-virtual-screeningbio-chemoinformatics-admet-prediction